CymitQuimica logo

CAS 131206-15-0

:

(R)-N-1-Phenylethyl-N'-triethoxysilylpropylurea

Description:
(R)-N-1-Phenylethyl-N'-triethoxysilylpropylurea, with the CAS number 131206-15-0, is a chemical compound that features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two nitrogen atoms. This compound is notable for its triethoxysilyl group, which enhances its reactivity and potential applications in silane chemistry, particularly in the modification of surfaces and materials. The presence of the phenylethyl group contributes to its hydrophobic characteristics, while the triethoxysilyl moiety allows for covalent bonding to silicate surfaces, making it useful in various fields such as materials science, coatings, and adhesives. Additionally, the chiral center in the (R)-configuration indicates that the compound may exhibit specific biological activities or interactions, which could be relevant in pharmaceutical applications. Overall, this compound's unique structure and functional groups make it a versatile candidate for research and industrial applications.
Formula:C18H32N2O4Si
InChI:InChI=1/C18H32N2O4Si/c1-5-22-25(23-6-2,24-7-3)15-11-14-19-18(21)20-16(4)17-12-9-8-10-13-17/h8-10,12-13,16H,5-7,11,14-15H2,1-4H3,(H2,19,20,21)
SMILES:CCO[Si](CCCN=C(NC(C)c1ccccc1)O)(OCC)OCC
Synonyms:
  • (S)-N-1-Phenylethyl-N-triethoxysilylpropylurea
  • 1-(1-Phenylethyl)-3-[3-(Triethoxysilyl)Propyl]Urea
  • (R)-N-1-Phenylethyl-N'-Triethoxysilylpropylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.