CAS 13121-61-4
:1,3,4,5-tetra-O-acetyl-2,6-anhydrohexitol
Description:
1,3,4,5-Tetra-O-acetyl-2,6-anhydrohexitol is a chemical compound characterized by its structure, which includes multiple acetyl groups and an anhydrohexitol framework. This compound is a derivative of a sugar alcohol, specifically a hexitol, and features four acetyl groups that enhance its stability and solubility in organic solvents. The presence of the anhydro structure indicates that it has undergone dehydration, which can influence its reactivity and physical properties. Typically, such compounds exhibit a white crystalline appearance and are soluble in polar organic solvents. They may be used in various applications, including organic synthesis and as intermediates in the production of more complex molecules. The acetyl groups can be hydrolyzed under specific conditions, allowing for the regeneration of the parent hexitol structure. Additionally, the compound's properties, such as melting point and boiling point, are influenced by the degree of acetylation and the overall molecular weight. As with many organic compounds, handling should be done with care, considering potential reactivity and safety protocols.
Formula:C14H20O9
InChI:InChI=1/C14H20O9/c1-7(15)19-5-11-13(22-9(3)17)14(23-10(4)18)12(6-20-11)21-8(2)16/h11-14H,5-6H2,1-4H3
SMILES:CC(=O)OCC1C(C(C(CO1)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- (2R,3R,4R,5S)-3,4,5-triacetoxy-2-(acetoxymethyl)tetrahydropyran
- (2R,3S,4R,5S)-3,4,5-triacetoxy-2-(acetoxymethyl)tetrahydropyran
- 1,3,4,5-Tetra-O-acetyl-2,6-anhydrohexitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Mannitol, 1,5-anhydro-, 2,3,4,6-tetraacetate
CAS:Formula:C14H20O9Color and Shape:LiquidMolecular weight:332.30322,3,4,6-Tetra-O-acetyl-1,5-anhydro-D-mannitol
CAS:2,3,4,6-Tetra-O-acetyl-1,5-anhydro-D-mannitol is a high yield precursor for the production of the drug 2,3,4,6-tetraacetoxybenzoin. The anomers are selectively formed by reacting with chlorides and iodides at elevated temperatures. The reaction yields the diastereomeric mixture of tetraacetoxybenzoin in a ratio of about 1:2. This product also reacts with acetobromoglucose to produce acrylonitrile (ACN). 2,3,4,6-Tetra-O-acetyl-1,5-anhydro-D-mannitol is a catalytic precursor for the production of the drug 2-(pyranosyl)-1-[2-(chloro)acetylamino]-2-(nitrophenyl)ethanol (PAN). This product can beFormula:C14H20O9Purity:Min. 95%Molecular weight:332.3 g/mol


