
CAS 1312117-82-0
:7,8-Dihydro-4-hydroxy-2,5(1H,6H)-quinolinedione
Description:
7,8-Dihydro-4-hydroxy-2,5(1H,6H)-quinolinedione, identified by its CAS number 1312117-82-0, is a chemical compound that belongs to the class of quinolinediones. This substance features a bicyclic structure characterized by a quinoline core with two carbonyl groups and a hydroxyl group, contributing to its potential reactivity and biological activity. The presence of the hydroxy group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The compound may also display antioxidant properties due to its ability to donate electrons, which can be beneficial in various biochemical applications. Additionally, its structural features may allow it to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. While specific applications and biological activities may vary, compounds of this nature are often explored for their potential therapeutic effects, including anti-inflammatory and antimicrobial properties. Further research is necessary to fully elucidate its characteristics and potential uses in various fields.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c11-6-3-1-2-5-9(6)7(12)4-8(13)10-5/h4H,1-3H2,(H2,10,12,13)
InChI key:InChIKey=ZDHKAUVUFUSVRR-UHFFFAOYSA-N
SMILES:OC=1C2=C(NC(=O)C1)CCCC2=O
Synonyms:- 7,8-Dihydro-4-hydroxy-2,5(1H,6H)-quinolinedione
- 2,5(1H,6H)-Quinolinedione, 7,8-dihydro-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.