
CAS 1312131-56-8
:N-[[(8-Quinolinylmethyl)amino]carbonyl]-β-alanine
Description:
N-[[(8-Quinolinylmethyl)amino]carbonyl]-β-alanine is a chemical compound characterized by its unique structure, which includes a quinoline moiety linked to a β-alanine backbone through an amide bond. This compound typically exhibits properties associated with both the quinoline and amino acid functional groups, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of amino and carbonyl groups. The quinoline ring contributes to its aromatic character, which may influence its electronic properties and reactivity. Additionally, the β-alanine component may impart biological relevance, as amino acids are fundamental in various biochemical processes. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its specific interactions, stability, and reactivity would depend on the surrounding environment and conditions, such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C14H15N3O3
InChI:InChI=1S/C14H15N3O3/c18-12(19)6-8-16-14(20)17-9-11-4-1-3-10-5-2-7-15-13(10)11/h1-5,7H,6,8-9H2,(H,18,19)(H2,16,17,20)
InChI key:InChIKey=OZBDVQKOHBBLSY-UHFFFAOYSA-N
SMILES:C(NC(NCCC(O)=O)=O)C=1C2=C(C=CC1)C=CC=N2
Synonyms:- β-Alanine, N-[[(8-quinolinylmethyl)amino]carbonyl]-
- N-[[(8-Quinolinylmethyl)amino]carbonyl]-β-alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.