
CAS 1312141-20-0
:3-[2-(Dimethylamino)-2-oxoethoxy]benzenepropanoic acid
Description:
3-[2-(Dimethylamino)-2-oxoethoxy]benzenepropanoic acid, identified by its CAS number 1312141-20-0, is a chemical compound characterized by its complex structure that includes a benzene ring, a propanoic acid moiety, and a dimethylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility, reactivity, and biological activity. The presence of the dimethylamino group suggests potential basicity, which may enhance its interaction with biological targets, making it of interest in pharmaceutical applications. The oxoethoxy group contributes to its overall polarity, affecting its solubility in various solvents. Additionally, the carboxylic acid functional group is likely to participate in hydrogen bonding, influencing its behavior in solution and its reactivity in chemical reactions. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation for potential therapeutic uses.
Formula:C13H17NO4
InChI:InChI=1S/C13H17NO4/c1-14(2)12(15)9-18-11-5-3-4-10(8-11)6-7-13(16)17/h3-5,8H,6-7,9H2,1-2H3,(H,16,17)
InChI key:InChIKey=OWSKBVUPPZLRMH-UHFFFAOYSA-N
SMILES:O(CC(N(C)C)=O)C1=CC(CCC(O)=O)=CC=C1
Synonyms:- 3-[2-(Dimethylamino)-2-oxoethoxy]benzenepropanoic acid
- Benzenepropanoic acid, 3-[2-(dimethylamino)-2-oxoethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.