CymitQuimica logo

CAS 1312161-61-7

:

Phenylmethyl (3S)-3-(aminomethyl)-4-morpholinecarboxylate

Description:
Phenylmethyl (3S)-3-(aminomethyl)-4-morpholinecarboxylate, identified by its CAS number 1312161-61-7, is a chemical compound characterized by its unique structural features. It contains a morpholine ring, which is a six-membered heterocyclic structure with one nitrogen atom, contributing to its potential biological activity. The presence of an aminomethyl group indicates that it has an amine functional group, which can participate in hydrogen bonding and may enhance its solubility in polar solvents. The phenylmethyl moiety suggests that the compound may exhibit hydrophobic characteristics, influencing its interaction with biological membranes. This compound is likely to be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as an intermediate in the synthesis of more complex molecules or as a lead compound in drug development. Its stereochemistry, indicated by the (3S) designation, may also play a crucial role in its biological activity, as the spatial arrangement of atoms can significantly affect how the molecule interacts with biological targets.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c14-8-12-10-17-7-6-15(12)13(16)18-9-11-4-2-1-3-5-11/h1-5,12H,6-10,14H2/t12-/m0/s1
InChI key:InChIKey=PHVGNIVBGOBZCV-LBPRGKRZSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2[C@@H](CN)COCC2
Synonyms:
  • 4-Morpholinecarboxylic acid, 3-(aminomethyl)-, phenylmethyl ester, (3S)-
  • Benzyl(S)-3-(aminomethyl)morpholine-4-carboxylate
  • Phenylmethyl (3S)-3-(aminomethyl)-4-morpholinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.