CAS 13123-00-7
:Z-Phe-Val-OH
Description:
Z-Phe-Val-OH, also known as Z-phenylvaline, is a synthetic peptide derivative characterized by the presence of a phenylalanine (Phe) and valine (Val) amino acid sequence, with a protective Z (benzyloxycarbonyl) group at the amino terminus. This compound is typically utilized in peptide synthesis and research due to its role as a building block in the formation of more complex peptides. The Z group serves to protect the amino group during synthesis, allowing for selective reactions at other functional groups. Z-Phe-Val-OH is generally soluble in organic solvents and exhibits stability under standard laboratory conditions. Its properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. As a peptide derivative, it may exhibit biological activity, making it of interest in pharmacological studies. However, specific applications and interactions would depend on the context of its use in research or therapeutic settings.
Formula:C22H26N2O5
InChI:InChI=1S/C22H26N2O5/c1-15(2)19(21(26)27)24-20(25)18(13-16-9-5-3-6-10-16)23-22(28)29-14-17-11-7-4-8-12-17/h3-12,15,18-19H,13-14H2,1-2H3,(H,23,28)(H,24,25)(H,26,27)/t18-,19-/m0/s1
InChI key:InChIKey=AJQYZRHQCXCROF-OALUTQOASA-N
SMILES:[C@@H](C(N[C@@H]([C@H](C)C)C(O)=O)=O)(CC1=CC=CC=C1)NC(OCC2=CC=CC=C2)=O
Synonyms:- (Benzoyloxycarbonyl)-<span class="text-smallcaps">L</smallcap>-phenylalanyl-<smallcap>L</span>-valine
- <span class="text-smallcaps">L</smallcap>-Valine, N-[(phenylmethoxy)carbonyl]-<smallcap>L</span>-phenylalanyl-
- <span class="text-smallcaps">L</smallcap>-Valine, N-[N-[(phenylmethoxy)carbonyl]-<smallcap>L</span>-phenylalanyl]-
- L-Valine, N-(N-((phenylmethoxy)carbonyl)-L-phenylalanyl)-
- N-(Benzyloxycarbonyl)-<span class="text-smallcaps">L</smallcap>-phenylalanyl-<smallcap>L</span>-valine
- N-(Benzyloxycarbonyl)phenylalanylvaline
- N-(N-((Benzoyloxy)carbonyl)-L-phenylalanyl)-L-valine
- N-Benzyloxycarbonylphenylalanyl-valine
- N-[(Phenylmethoxy)carbonyl]-<span class="text-smallcaps">L</smallcap>-phenylalanyl-<smallcap>L</span>-valine
- NSC 322479
- Valine, N-(N-carboxy-3-phenyl-<span class="text-smallcaps">L</smallcap>-alanyl)-, N-benzyl ester, <smallcap>L</span>-
- Valine, N-(N-carboxy-3-phenyl-<span class="text-smallcaps">L</span>-alanyl)-, N-benzyl ester
- Valine, N-(N-carboxy-3-phenyl-L-alanyl)-, N-benzyl ester, L-
- L-Valine, N-[(phenylmethoxy)carbonyl]-L-phenylalanyl-
- N-[(Phenylmethoxy)carbonyl]-L-phenylalanyl-L-valine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
L-Valine, N-[(phenylmethoxy)carbonyl]-L-phenylalanyl-
CAS:Formula:C22H26N2O5Molecular weight:398.4522Z-Phe-Val-OH
CAS:Z-Phe-Val-OH is an optical isomer of the molecule Z-Val-OH. It can be synthesized from the reactants Isobutyl, Chloroformate, and Hydrophobic. This synthetic product has been shown to have high yields and specificities. The chiral center in this molecule causes it to rotate light in one direction or another, which means that it can be used to create a spectrum of colors. The synthesis of this molecule takes place in a kinetically controlled manner. When mixed with amines, carboxylic acids, and tripeptides, this compound will form a tripeptide bond with two amino acids on either side of the peptide chain.
Formula:C22H26N2O5Purity:Min. 95%Molecular weight:398.45 g/mol

