CAS 131230-67-6
:N-(2-chloromethylphenyl)-3,3-difluoroazetidin-2-one
Description:
N-(2-chloromethylphenyl)-3,3-difluoroazetidin-2-one is a chemical compound characterized by its unique structure, which includes an azetidinone ring, a chloromethylphenyl group, and two fluorine atoms attached to the azetidinone. This compound typically exhibits properties such as moderate polarity due to the presence of halogen substituents, which can influence its solubility in various solvents. The azetidinone moiety suggests potential reactivity, particularly in nucleophilic substitution reactions, while the difluoro substituents may enhance its stability and lipophilicity. The presence of the chloromethyl group can also provide sites for further chemical modifications. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing more complex molecules. As with many fluorinated compounds, it may exhibit unique pharmacokinetic properties, making it a candidate for further research in drug development or agrochemical applications. Safety and handling considerations should be taken into account due to the presence of halogens and the potential for toxicity.
Formula:C10H8ClF2NO
InChI:InChI=1/C10H8ClF2NO/c11-5-7-3-1-2-4-8(7)14-6-10(12,13)9(14)15/h1-4H,5-6H2
SMILES:c1ccc(c(c1)CCl)N1CC(C1=O)(F)F
Synonyms:- Aa 231-1
- Cmpdf
- 2-Azetidinone, 1-(2-(chloromethyl)phenyl)-3,3-difluoro-
- 1-[2-(Chloromethyl)Phenyl]-3,3-Difluoroazetidin-2-One
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Azetidinone, 1-[2-(chloromethyl)phenyl]-3,3-difluoro-
CAS:Formula:C10H8ClF2NOMolecular weight:231.6264
