CAS 1312306-26-5

2-Amino-3-ethoxy-N-(phenylmethyl)propanamide

Description:

2-Amino-3-ethoxy-N-(phenylmethyl)propanamide is an organic compound characterized by its amide functional group, which is indicative of its potential as a building block in medicinal chemistry. The presence of an amino group suggests basic properties, while the ethoxy group contributes to its hydrophobic characteristics, potentially influencing its solubility and permeability in biological systems. The phenylmethyl substituent enhances the compound's lipophilicity, which may affect its interaction with biological targets. This compound's structure suggests it could participate in hydrogen bonding due to the amine and carbonyl functionalities, which may be relevant for its biological activity. Additionally, the presence of multiple functional groups indicates that it may exhibit diverse reactivity and could be synthesized or modified for various applications in pharmaceuticals or agrochemicals. Overall, the unique combination of functional groups in 2-Amino-3-ethoxy-N-(phenylmethyl)propanamide positions it as a potentially interesting compound for further research and development in chemical and biological contexts.

Formula: C₁₂H₁₈N₂O₂

InChI: InChI=1S/C12H18N2O2/c1-2-16-9-11(13)12(15)14-8-10-6-4-3-5-7-10/h3-7,11H,2,8-9,13H2,1H3,(H,14,15)

InChI key: InChIKey=QTVRDCQVKXVLMX-UHFFFAOYSA-N

SMILES: C(NC(C(COCC)N)=O)C1=CC=CC=C1

Synonyms:

• Propanamide, 2-amino-3-ethoxy-N-(phenylmethyl)-
• 2-Amino-3-ethoxy-N-(phenylmethyl)propanamide