CAS 1312309-63-9

3-[2-(2-Azidoethoxy)ethoxy]propanoic acid

Description:

3-[2-(2-Azidoethoxy)ethoxy]propanoic acid is a chemical compound characterized by its azido and ether functional groups, which contribute to its reactivity and potential applications in organic synthesis and bioconjugation. The presence of the azido group (-N3) makes it a useful intermediate in click chemistry, allowing for selective reactions with alkyne-containing compounds. The ether linkages provide stability and solubility in various organic solvents, enhancing its utility in laboratory settings. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its propanoic acid moiety imparts acidic properties, making it relevant in various chemical reactions, including esterification and amidation. Safety considerations should be taken into account due to the azido group, which can be sensitive to heat and shock. Overall, 3-[2-(2-Azidoethoxy)ethoxy]propanoic acid is a versatile compound with significant potential in chemical research and development.

Formula: C₇H₁₃N₃O₄

InChI: InChI=1S/C7H13N3O4/c8-10-9-2-4-14-6-5-13-3-1-7(11)12/h1-6H2,(H,11,12)

InChI key: InChIKey=IEHDSRSXQAOLJT-UHFFFAOYSA-N

SMILES: O(CCOCCN=[N+]=[N-])CCC(O)=O

Synonyms:

• Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-
• 9-Azido-4,7-dioxanonanoic acid
• 3-[2-(2-Azidoethoxy)ethoxy]propanoic acid

3-[2-(2-Azidoethoxy)ethoxy]propanoic acid

CAS: 1312309-63-9

Formula: C₇H₁₃N₃O₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 203.1958

Ref: IN-DA003AOM

Azido-PEG2-C2-acid

CAS: 1312309-63-9

Azido-PEG2-C2-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₇H₁₃N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.2

Ref: TM-T14418

Azido-PEG2-C2-acid

CAS: 1312309-63-9

Azido-PEG2-C2-acid

Purity: 97%

Molecular weight: 203.2g/mol

Ref: 54-OR1036118

{2-[2-(2-carboxyethoxy)ethoxy]ethyl}(diazyn-1-ium-1-yl)azanide

CAS: 1312309-63-9

Purity: 95%

Molecular weight: 203.197998

Ref: 10-F862559