CymitQuimica logo

CAS 1312312-78-9

:

1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine

Description:
1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[3,4-b]pyridine is a chemical compound characterized by its unique structure, which combines a pyrazolo[3,4-b]pyridine core with a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests that this compound may exhibit interesting reactivity, particularly in organoboron chemistry, which is often utilized in cross-coupling reactions and as a building block in organic synthesis. The methyl group at the 1-position of the pyrazole ring can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interactions with other molecules. Additionally, the compound may possess specific solubility characteristics, depending on the solvent used, and could exhibit biological activity, making it of interest in medicinal chemistry. Overall, the combination of the pyrazolo[3,4-b]pyridine framework and the boron functionality provides a versatile platform for further chemical exploration and application.
Formula:C13H18BN3O2
InChI:InChI=1S/C13H18BN3O2/c1-12(2)13(3,4)19-14(18-12)10-6-9-7-16-17(5)11(9)15-8-10/h6-8H,1-5H3
InChI key:KXMPXUQJTUXRRL-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)N(N=C3)C
Found 4 products.