CAS 1312368-92-5

B-1H-Pyrrolo[3,2-b]pyridin-5-ylboronic acid

Description:

B-1H-Pyrrolo[3,2-b]pyridin-5-ylboronic acid is an organic compound characterized by its boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyrrolo[3,2-b]pyridine core, which contributes to its aromaticity and potential biological activity. The presence of the boronic acid moiety allows for applications in medicinal chemistry, particularly in the development of inhibitors for various enzymes, including proteases and kinases. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents. Its reactivity is influenced by the boron atom, which can participate in various chemical reactions, including Suzuki coupling, making it valuable in synthetic organic chemistry. Additionally, the structural features of this compound may impart specific pharmacological properties, making it a subject of interest in drug discovery and development. Overall, B-1H-Pyrrolo[3,2-b]pyridin-5-ylboronic acid represents a versatile scaffold in both synthetic and medicinal chemistry.

Formula: C₇H₇BN₂O₂

InChI: InChI=1S/C7H7BN2O2/c11-8(12)7-2-1-5-6(10-7)3-4-9-5/h1-4,9,11-12H

InChI key: InChIKey=IIWKGDSXFGALFM-UHFFFAOYSA-N

SMILES: B(O)(O)C=1N=C2C(=CC1)NC=C2

Synonyms:

• [1H-Pyrrolo[3,2-b]pyridin-5-yl]boronic acid
• Boronic acid, B-1H-pyrrolo[3,2-b]pyridin-5-yl-
• B-1H-Pyrrolo[3,2-b]pyridin-5-ylboronic acid
• 1H-Pyrrolo[3,2-b]pyridin-5-ylboronic acid