CymitQuimica logo

CAS 131238-01-2

:

N-(4-azido-2,3,5,6-tetrafluorobenzoyl)tyrosine

Description:
N-(4-azido-2,3,5,6-tetrafluorobenzoyl)tyrosine is a chemical compound characterized by its unique structure, which includes an azido group and a tetrafluorobenzoyl moiety attached to the amino acid tyrosine. This compound is notable for its potential applications in bioconjugation and as a photoaffinity label due to the presence of the azido group, which can undergo click chemistry reactions when exposed to light. The tetrafluorobenzoyl group enhances the compound's hydrophobicity and stability, making it suitable for various biochemical applications. Additionally, the presence of fluorine atoms in the benzoyl ring can influence the compound's electronic properties and reactivity. As a derivative of tyrosine, it retains the amino acid's functional characteristics, allowing for interactions with biological systems. Overall, N-(4-azido-2,3,5,6-tetrafluorobenzoyl)tyrosine is a versatile compound with significant potential in chemical biology and medicinal chemistry research.
Formula:C16H10F4N4O4
InChI:InChI=1/C16H10F4N4O4/c17-10-9(11(18)13(20)14(12(10)19)23-24-21)15(26)22-8(16(27)28)5-6-1-3-7(25)4-2-6/h1-4,8,25H,5H2,(H,22,26)(H,27,28)/t8-/m0/s1
SMILES:c1cc(ccc1C[C@@H](C(=O)O)N=C(c1c(c(c(c(c1F)F)N=[N+]=[NH-])F)F)O)O
Synonyms:
  • Atfbt
  • L-Tyrosine, N-(4-azido-2,3,5,6-tetrafluorobenzoyl)-
  • N-[(4-azido-2,3,5,6-tetrafluorophenyl)carbonyl]-L-tyrosine
  • N-(4-Azido-2,3,5,6-tetrafluorobenzoyl)tyrosine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.