CymitQuimica logo

CAS 131238-06-7

:

succinimidyl 2-(4-azido-2,3,5,6-tetrafluorophenyl)thiazole-4-carboxylate

Description:
Succinimidyl 2-(4-azido-2,3,5,6-tetrafluorophenyl)thiazole-4-carboxylate is a chemical compound characterized by its unique structure, which includes a succinimide moiety and a thiazole ring substituted with an azido group and multiple fluorine atoms. This compound is typically used in bioconjugation applications, particularly in the labeling of biomolecules due to the presence of the azido group, which can undergo click chemistry reactions. The fluorinated phenyl group enhances its photophysical properties, making it useful in fluorescence-based assays. The thiazole ring contributes to the compound's stability and reactivity. Additionally, the succinimidyl ester functionality allows for the formation of stable amide bonds with amine-containing molecules, facilitating the conjugation process. Overall, this compound is valuable in chemical biology and materials science for its ability to selectively label and modify proteins and other biomolecules. Its specific reactivity and stability make it a versatile tool in various research applications.
Formula:C14H5F4N5O4S
InChI:InChI=1/C14H5F4N5O4S/c15-8-7(9(16)11(18)12(10(8)17)21-22-19)13-20-4(3-28-13)14(26)27-23-5(24)1-2-6(23)25/h3H,1-2H2
SMILES:C1CC(=O)N(C1=O)OC(=O)c1csc(c2c(c(c(c(c2F)F)N=[N+]=[NH-])F)F)n1
Synonyms:
  • Satfpt
  • 2,5-Pyrrolidinedione, 1-(((2-(4-azido-2,3,5,6-tetrafluorophenyl)-4-thiazolyl)carbonyl)oxy)-
  • 1-({[2-(4-Azido-2,3,5,6-Tetrafluorophenyl)-1,3-Thiazol-4-Yl]Carbonyl}Oxy)Pyrrolidine-2,5-Dione
  • Succinimidyl 2-(4-azido-2,3,5,6-tetrafluorophenyl)thiazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.