CAS 13124-09-9
:4-(3,4-Dichlorophenyl)-3-thiosemicarbazide
Description:
4-(3,4-Dichlorophenyl)-3-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which features a sulfur atom bonded to a carbonyl group and an amine. This compound typically appears as a solid and is known for its potential biological activity, including antimicrobial and anticancer properties. The presence of the dichlorophenyl group enhances its reactivity and may influence its interaction with biological targets. It is soluble in various organic solvents, which makes it useful in synthetic applications. The compound's structure allows for hydrogen bonding and potential coordination with metal ions, which can be significant in medicinal chemistry. Safety data indicates that, like many thiosemicarbazides, it should be handled with care due to potential toxicity. Overall, 4-(3,4-Dichlorophenyl)-3-thiosemicarbazide is of interest in both research and pharmaceutical contexts, warranting further investigation into its properties and applications.
Formula:C7H7Cl2N3S
InChI:InChI=1/C7H7Cl2N3S/c8-5-2-1-4(3-6(5)9)11-12-7(10)13/h1-3,11H,(H3,10,12,13)
SMILES:c1cc(c(cc1NNC(=N)S)Cl)Cl
Synonyms:- N-(3,4-dichlorophenyl)hydrazinecarbothioamide
- 2-(3,4-Dichlorophenyl)Hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-(3,4-Dichlorophenyl)-3-thiosemicarbazide
CAS:4-(3,4-Dichlorophenyl)-3-thiosemicarbazide
Molecular weight:236.12158g/mol4-(3,4-Dichlorophenyl)-3-thiosemicarbazide
CAS:Formula:C7H7Cl2N3SColor and Shape:SolidMolecular weight:236.11



