CymitQuimica logo

CAS 13124-69-1

:

4,7,7-Trimethylbicyclo[4.1.0]heptan-3-one

Description:
4,7,7-Trimethylbicyclo[4.1.0]heptan-3-one, with the CAS number 13124-69-1, is a bicyclic ketone characterized by its unique structural framework, which consists of a bicycloheptane core with three methyl groups and a ketone functional group. This compound exhibits a complex three-dimensional structure, contributing to its potential applications in organic synthesis and fragrance chemistry. The presence of the ketone group indicates that it may participate in various chemical reactions, such as nucleophilic addition or condensation. Its molecular structure suggests that it may possess interesting physical properties, including volatility and solubility characteristics that could be influenced by the bulky methyl substituents. Additionally, the compound's stereochemistry may play a significant role in its reactivity and interactions with other molecules. While specific data on its reactivity and applications may vary, compounds of this type are often explored for their potential use in the synthesis of more complex organic molecules or as intermediates in various chemical processes.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-6-4-7-8(5-9(6)11)10(7,2)3/h6-8H,4-5H2,1-3H3
InChI key:InChIKey=ABSCYWMYRVUUIC-UHFFFAOYSA-N
SMILES:CC1(C)C2C1CC(=O)C(C)C2
Synonyms:
  • Bicyclo[4.1.0]heptan-3-one, 4,7,7-trimethyl-
  • 4,7,7-Trimethylbicyclo[4.1.0]heptan-3-one
  • 4-Caranone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.