CAS 1312478-93-5
:2-[3-Fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]tetrahydro-2H-pyran
Description:
2-[3-Fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]tetrahydro-2H-pyran is a complex organic compound characterized by its unique structural features, including a tetrahydropyran ring and a phenoxy group substituted with a fluorine atom and a boron-containing moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The dioxaborolane group is notable for its potential applications in medicinal chemistry, particularly in drug design and development, due to its ability to form stable complexes with various biological targets. This compound may exhibit interesting properties such as solubility in organic solvents, stability under certain conditions, and reactivity that can be tailored for specific applications. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic synthesis. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various fields.
Formula:C18H26BFO4
InChI:InChI=1S/C18H26BFO4/c1-12-14(22-15-8-6-7-11-21-15)10-9-13(16(12)20)19-23-17(2,3)18(4,5)24-19/h9-10,15H,6-8,11H2,1-5H3
InChI key:InChIKey=RPWLRVFHYWWVCT-UHFFFAOYSA-N
SMILES:FC1=C(B2OC(C)(C)C(C)(C)O2)C=CC(OC3CCCCO3)=C1C
Synonyms:- 2-[3-Fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]tetrahydro-2H-pyran
- 2H-Pyran, 2-[3-fluoro-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]tetrahydro-
- 2-Fluoro-3-methyl-4-tetrahydropyranoxybenzeneboronic acid pinacol ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.