CymitQuimica logo

CAS 13125-44-5

:

bisnorlipoate

Description:
Bisnorlipoate, with the CAS number 13125-44-5, is a chemical compound that belongs to the class of lipoic acid derivatives. It is characterized by the presence of two lipoate moieties, which are sulfur-containing compounds known for their antioxidant properties. Bisnorlipoate is typically recognized for its potential applications in biochemical research and as a reagent in organic synthesis. The compound exhibits solubility in various organic solvents, making it useful in different chemical environments. Its structure includes multiple functional groups that can participate in redox reactions, contributing to its role in biological systems and potential therapeutic applications. Additionally, bisnorlipoate may interact with metal ions and other biomolecules, influencing cellular processes. While specific data on its toxicity and environmental impact may vary, it is essential to handle it with care, following appropriate safety protocols in laboratory settings. Overall, bisnorlipoate serves as an interesting subject for further studies in medicinal chemistry and biochemistry.
Formula:C6H10O2S2
InChI:InChI=1/C6H10O2S2/c7-6(8)2-1-5-3-4-9-10-5/h5H,1-4H2,(H,7,8)
SMILES:C(CC(=O)O)C1CCSS1
Synonyms:
  • 4,6-Dithiohexanoate
  • 4,6-Dithiohexanoic acid
  • 1,2-Dithiolane-3-propanoic acid
  • 3-(1,2-Dithiolan-3-Yl)Propanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.