CAS 1312556-57-2

1-Methyl-1H-benzotriazole-7-carboxylic acid

Description:

1-Methyl-1H-benzotriazole-7-carboxylic acid is an organic compound characterized by its benzotriazole structure, which features a triazole ring fused to a benzene ring. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar solvents like water and alcohols, owing to the presence of the carboxylic acid functional group. It is known for its applications in various fields, including corrosion inhibition, as it can form stable complexes with metal ions, thereby protecting metal surfaces from oxidation. Additionally, the methyl group at the 1-position of the benzotriazole enhances its lipophilicity, which can influence its biological activity and interaction with other substances. The compound may also exhibit UV-absorbing properties, making it useful in formulations requiring protection from ultraviolet light. As with many benzotriazole derivatives, it is important to consider its environmental impact and toxicity, particularly in aquatic systems, where it may affect aquatic organisms.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-11-7-5(8(12)13)3-2-4-6(7)9-10-11/h2-4H,1H3,(H,12,13)

InChI key: InChIKey=WTSDEEIKBRDWIN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CC=C1)N=NN2C

Synonyms:

• 1-Methyl-1H-1,2,3-benzotriazole-7-carboxylic acid
• 1H-Benzotriazole-7-carboxylic acid, 1-methyl-
• 1-Methyl-1H-benzotriazole-7-carboxylic acid

1-Methyl-1H-1,2,3-benzotriazole-7-carboxylic acid

CAS: 1312556-57-2

Versatile small molecule scaffold

Formula: C₈H₇N₃O₂

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-MCC55657