CymitQuimica logo

CAS 1312556-61-8

:

Methyl 2-methyl-2H-benzotriazole-4-carboxylate

Description:
Methyl 2-methyl-2H-benzotriazole-4-carboxylate is an organic compound characterized by its benzotriazole structure, which features a triazole ring fused to a benzene ring. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents like ethanol and acetone but has limited solubility in water. The presence of the carboxylate group contributes to its potential reactivity and ability to form salts. Methyl 2-methyl-2H-benzotriazole-4-carboxylate is often utilized in various applications, including as a corrosion inhibitor, UV stabilizer, and in the synthesis of other chemical compounds. Its unique structure allows it to interact with metal ions, making it valuable in protecting materials from degradation. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-12-10-7-5-3-4-6(8(7)11-12)9(13)14-2/h3-5H,1-2H3
InChI key:InChIKey=KOPCRNXGZDIFKX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(=NN(C)N2)C=CC1
Synonyms:
  • Methyl 2-methyl-2H-benzotriazole-4-carboxylate
  • 2H-Benzotriazole-4-carboxylic acid, 2-methyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.