CAS 13126-39-1
:cis-13-octadecenoic acid
Description:
Cis-13-octadecenoic acid, also known as cis-13-docosenoic acid, is a monounsaturated fatty acid characterized by a long hydrocarbon chain containing 18 carbon atoms and a single cis double bond located at the 13th carbon from the carboxylic acid end. This structural feature contributes to its unique physical and chemical properties, such as a lower melting point compared to saturated fatty acids of similar chain length, making it liquid at room temperature. It is typically found in various natural oils and fats, particularly in certain plant oils. The presence of the cis configuration influences its biological activity and nutritional value, as it can affect membrane fluidity and is involved in various metabolic processes. Additionally, cis-13-octadecenoic acid can be utilized in the production of biodiesel and as a precursor for the synthesis of various chemical compounds in the food and cosmetic industries. Its CAS number, 13126-39-1, is a unique identifier used for regulatory and safety purposes in chemical databases.
Formula:C18H34O2
InChI:InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-6H,2-4,7-17H2,1H3,(H,19,20)/b6-5+
InChI key:InChIKey=BDLLSHRIFPDGQB-WAYWQWQTSA-N
SMILES:C(CCCCC/C=C\CCCC)CCCCCC(O)=O
Synonyms:- (13E)-octadec-13-enoic acid
- (13Z)-13-Octadecenoic acid
- (13Z)-octadec-13-enoic acid
- (Z)-13-Octadecenoic acid
- 13(Z)-Octadecenoic acid
- 13-Octadecenoic acid
- 13-Octadecenoic acid, (13Z)-
- 13-Octadecenoic acid, (Z)-
- Octadec-13-Enoic Acid
- Δ<sup>13</sup>-cis-Octadecenoic acid
- Δ13-cis-Octadecenoic acid
- cis-13-Octadecenoic acid
- (13Z)-octadecenoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
13-Octadecenoic acid, (13Z)-
CAS:Formula:C18H34O2Purity:95%Color and Shape:LiquidMolecular weight:282.461413(Z)-Octadecenoic acid
CAS:Formula:C18H34O2Purity:>98%Color and Shape:In solution, EthanolMolecular weight:282.46cis-13-Octadecenoic Acid
CAS:Controlled ProductFormula:C18H34O2Color and Shape:NeatMolecular weight:282.46113(Z)-Octadecenoic acid
CAS:Please enquire for more information about 13(Z)-Octadecenoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C18H34O2Purity:Min. 95%Molecular weight:282.5 g/molcis-13-Octadecenoic Acid
CAS:Cis-13-Octadecenoic acid, a monounsaturated fatty acid, is identified in bovine milk fat.Formula:C18H34O2Color and Shape:SolidMolecular weight:282.46





