CAS 1312608-01-7

6,6-Dimethyl-4-(phenylmethyl)-2-morpholinone

Description:

6,6-Dimethyl-4-(phenylmethyl)-2-morpholinone is a chemical compound characterized by its morpholinone structure, which includes a morpholine ring substituted with a phenylmethyl group and two methyl groups at the 6-position. This compound typically exhibits properties associated with morpholinones, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the phenylmethyl group may impart additional hydrophobic characteristics, influencing its interactions in biological systems or chemical reactions. Morpholinones are often studied for their pharmacological properties, and this specific compound may exhibit unique biological activities due to its structural features. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies on its toxicity, reactivity, and specific applications would be necessary to fully understand its characteristics and potential uses. As with any chemical substance, proper handling and safety protocols should be observed when working with this compound.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-13(2)10-14(9-12(15)16-13)8-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3

InChI key: InChIKey=DHBTWOXJPAYWSW-UHFFFAOYSA-N

SMILES: C(N1CC(C)(C)OC(=O)C1)C2=CC=CC=C2

Synonyms:

• 2-Morpholinone, 6,6-dimethyl-4-(phenylmethyl)-
• 4-Benzyl-6,6-dimethylmorpholin-2-one
• 6,6-Dimethyl-4-(phenylmethyl)-2-morpholinone