CymitQuimica logo

CAS 1312609-73-6

:

4-(4-Bromo-1-naphthalenyl)phenol

Description:
4-(4-Bromo-1-naphthalenyl)phenol, identified by its CAS number 1312609-73-6, is an organic compound characterized by the presence of a brominated naphthalene moiety attached to a phenolic group. This compound typically exhibits a solid state at room temperature and is likely to be a crystalline substance. The bromine atom introduces both electronegative character and potential for reactivity, influencing its chemical behavior and interactions. The phenolic hydroxyl group contributes to its acidity and can participate in hydrogen bonding, affecting solubility in various solvents. Additionally, the compound may exhibit interesting optical properties due to the conjugated system formed by the naphthalene and phenol structures. Its potential applications could span across fields such as materials science, organic synthesis, and pharmaceuticals, particularly in the development of dyes or as intermediates in chemical reactions. Safety data should be consulted for handling and storage, as brominated compounds can pose health risks.
Formula:C16H11BrO
InChI:InChI=1S/C16H11BrO/c17-16-10-9-13(11-5-7-12(18)8-6-11)14-3-1-2-4-15(14)16/h1-10,18H
InChI key:InChIKey=WAPWIURRHWWKHY-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(=CC1)C3=CC=C(O)C=C3)C=CC=C2
Synonyms:
  • 4-(4-Bromo-1-naphthalenyl)phenol
  • Phenol, 4-(4-bromo-1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.