CAS 131263-08-6

α-[(2-Nitrophenyl)methylene]-1H-benzimidazole-2-acetonitrile

Description:

α-[(2-Nitrophenyl)methylene]-1H-benzimidazole-2-acetonitrile is a chemical compound characterized by its complex structure, which includes a benzimidazole core, a nitrophenyl group, and an acetonitrile moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the nitro and acetonitrile functional groups. The nitrophenyl group can impart significant electronic effects, influencing the compound's reactivity and interaction with other molecules. Additionally, the benzimidazole structure is known for its biological activity, making this compound of interest in medicinal chemistry. Its potential applications may include use as a pharmaceutical intermediate or in the development of agrochemicals. Safety and handling precautions are essential, as compounds containing nitro groups can be sensitive and may pose health risks. Overall, α-[(2-Nitrophenyl)methylene]-1H-benzimidazole-2-acetonitrile represents a unique chemical entity with diverse potential applications in research and industry.

Formula: C₁₆H₁₀N₄O₂

InChI: InChI=1S/C16H10N4O2/c17-10-12(9-11-5-1-4-8-15(11)20(21)22)16-18-13-6-2-3-7-14(13)19-16/h1-9H,(H,18,19)

InChI key: InChIKey=YGLWLRRYYPGJDG-UHFFFAOYSA-N

SMILES: C(=CC1=C(N(=O)=O)C=CC=C1)(C#N)C=2NC=3C(N2)=CC=CC3

Synonyms:

• α-[(2-Nitrophenyl)methylene]-1H-benzimidazole-2-acetonitrile
• 1H-Benzimidazole-2-acetonitrile, α-[(2-nitrophenyl)methylene]-

1H-Benzimidazole-2-acetonitrile, α-[(2-nitrophenyl)methylene]-

CAS: 131263-08-6

Formula: C₁₆H₁₀N₄O₂

Molecular weight: 290.2762

Ref: IN-DA000VTU