CymitQuimica logo

CAS 1312693-57-4

:

(1-(Difluoromethyl)-1H-pyrazol-4-yl)boronic acid

Description:
(1-(Difluoromethyl)-1H-pyrazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrazole ring that features a difluoromethyl substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the boronic acid group. The difluoromethyl group contributes to its unique reactivity and can influence its electronic properties, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. Boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in drug design and molecular recognition. Additionally, this compound may participate in cross-coupling reactions, a key feature in organic synthesis. Its specific reactivity and stability can be influenced by factors such as pH and the presence of other functional groups in a reaction environment. Overall, (1-(Difluoromethyl)-1H-pyrazol-4-yl)boronic acid is a versatile building block in chemical synthesis.
Formula:C4H5BF2N2O2
InChI:InChI=1S/C4H5BF2N2O2/c6-4(7)9-2-3(1-8-9)5(10)11/h1-2,4,10-11H
InChI key:UOXFJNMDWKLYQZ-UHFFFAOYSA-N
SMILES:B(C1=CN(N=C1)C(F)F)(O)O
Found 3 products.