CymitQuimica logo

CAS 1312713-26-0

:

1H-Pyrazole, 4-ethynyl-3-phenyl-

Description:
1H-Pyrazole, 4-ethynyl-3-phenyl- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethynyl group (-C≡CH) at the 4-position and a phenyl group (-C6H5) at the 3-position of the pyrazole ring, contributing to its unique reactivity and potential applications in various fields. The presence of the ethynyl group introduces alkyne characteristics, allowing for potential participation in reactions such as cross-coupling or cycloaddition. The phenyl group enhances the compound's stability and may influence its electronic properties. 1H-Pyrazole derivatives are often studied for their biological activities, including anti-inflammatory and antimicrobial properties. Additionally, this compound may serve as a building block in the synthesis of more complex molecules in medicinal chemistry. As with many pyrazole derivatives, it is important to consider its solubility, stability, and reactivity under various conditions when evaluating its practical applications.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c1-2-9-8-12-13-11(9)10-6-4-3-5-7-10/h1,3-8H,(H,12,13)
InChI key:InChIKey=NOPUAFGOPVZLOB-UHFFFAOYSA-N
SMILES:C(#C)C=1C(=NNC1)C2=CC=CC=C2
Synonyms:
  • 1H-Pyrazole, 4-ethynyl-3-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.