
CAS 1312784-54-5
:Piperazine, 1,2,2-trimethyl-, hydrochloride (1:1)
Description:
Piperazine, 1,2,2-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core structure, which is a six-membered heterocyclic ring containing two nitrogen atoms. This specific derivative features three methyl groups attached to the piperazine ring, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically encountered in a crystalline form, which improves its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The compound may exhibit properties such as basicity due to the presence of nitrogen atoms, allowing it to form salts with acids. Its structure suggests potential interactions with biological systems, making it of interest in medicinal chemistry. However, specific biological activities, toxicity, and pharmacokinetics would require further investigation through empirical studies. As with all chemical substances, proper handling and safety protocols should be observed, particularly in laboratory settings.
Formula:C7H16N2·ClH
InChI:InChI=1S/C7H16N2.ClH/c1-7(2)6-8-4-5-9(7)3;/h8H,4-6H2,1-3H3;1H
InChI key:InChIKey=AWYYVHSHGGSKCG-UHFFFAOYSA-N
SMILES:CN1C(C)(C)CNCC1.Cl
Synonyms:- Piperazine, 1,2,2-trimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
