
CAS 1312784-78-3
:N,N,4-Trimethyl-1-(phenylmethyl)-4-piperidinamine
Description:
N,N,4-Trimethyl-1-(phenylmethyl)-4-piperidinamine is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a phenylmethyl group and three methyl groups on the nitrogen atom. This compound is classified as an amine due to the presence of the amine functional group, which contributes to its basicity and potential reactivity. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The trimethyl substitution on the nitrogen atom may affect steric hindrance and electronic properties, impacting its interaction with biological targets. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. However, specific data regarding its solubility, stability, and toxicity would require further investigation through experimental studies. As with many organic compounds, safety precautions should be taken when handling it, and it should be stored under appropriate conditions to maintain its integrity.
Formula:C15H24N2
InChI:InChI=1S/C15H24N2/c1-15(16(2)3)9-11-17(12-10-15)13-14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3
InChI key:InChIKey=VQDVTUCGFYKSDZ-UHFFFAOYSA-N
SMILES:C(N1CCC(N(C)C)(C)CC1)C2=CC=CC=C2
Synonyms:- N,N,4-Trimethyl-1-(phenylmethyl)-4-piperidinamine
- 4-Piperidinamine, N,N,4-trimethyl-1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.