CAS 13129-21-0: 3-Thietanecarboxylic acid, 1,1-dioxide
Description:3-Thietanecarboxylic acid, 1,1-dioxide, also known as sulfolane, is a heterocyclic compound characterized by a five-membered ring containing a sulfur atom and an oxygen atom in its structure. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The presence of the sulfone group (1,1-dioxide) enhances its polarity and solubility in polar solvents, making it useful in various chemical applications. It is typically a colorless liquid with a high boiling point and low volatility, which makes it suitable as a solvent in chemical processes, particularly in the extraction of polar compounds. Additionally, its unique structure allows it to participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. Due to its properties, 3-thietanecarboxylic acid, 1,1-dioxide is utilized in organic synthesis and as a solvent in the petrochemical industry. Safety considerations include handling it with care, as it may pose health risks upon exposure.
Formula:C4H6O4S
InChI:InChI=1S/C4H6O4S/c5-4(6)3-1-9(7,8)2-3/h3H,1-2H2,(H,5,6)
InChI key:InChIKey=YRWVDUXZQYVBJF-UHFFFAOYSA-N
SMILES:O=C(O)C1CS(=O)(=O)C1
- Synonyms:
- 1,1-Dioxo-1λ6-thietane-3-carboxylic acid
- 1,1-Dioxothietane-3-carboxylic acid
- 3-Thietanecarboxylic acid, 1,1-dioxide
- Thietan-3-carboxylic acid 1,1-dioxide

3-Thietanecarboxylic acid, 1,1-dioxide
Ref: IN-DA000VVA
1g | To inquire | ||
100mg | 595.00 € | ||
250mg | 673.00 € | ||
500mg | To inquire |

Ref: 10-F363430
1g | 1,824.00 € | ||
100mg | 413.00 € | ||
250mg | 706.00 € | ||
500mg | 978.00 € |

3-Thietanecarboxylicacid,1,1-dioxide
Ref: 3D-NAA12921
50mg | 382.00 € | ||
500mg | 924.00 € |