CymitQuimica logo

CAS 13129-22-1

:

2H-Thiopyran-4-carboxylic acid, tetrahydro-, 1-oxide

Description:
2H-Thiopyran-4-carboxylic acid, tetrahydro-, 1-oxide, with the CAS number 13129-22-1, is a heterocyclic organic compound characterized by a thiopyran ring structure that incorporates a carboxylic acid functional group. This compound features a saturated tetrahydro configuration, indicating that it has a fully saturated ring system, which contributes to its stability and reactivity. The presence of the 1-oxide suggests that there is an oxygen atom bonded to the sulfur atom in the thiopyran ring, which can influence its chemical behavior and potential interactions. Typically, compounds of this nature may exhibit properties such as moderate solubility in polar solvents, potential acidity due to the carboxylic acid group, and the ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the thiopyran structure may impart unique biological activities, making it of interest in medicinal chemistry and material science. Overall, this compound's characteristics make it a subject of interest for further research and application in various fields.
Formula:C6H10O3S
InChI:InChI=1S/C6H10O3S/c7-6(8)5-1-3-10(9)4-2-5/h5H,1-4H2,(H,7,8)
InChI key:InChIKey=GMNLDRKSMPFJRH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCS(=O)CC1
Synonyms:
  • 1-Oxo-1λ4-thiane-4-carboxylic acid
  • 2H-Thiopyran-4-carboxylic acid, tetrahydro-, 1-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.