
CAS 13129-60-7
:2-[(5-Chloropentyl)oxy]tetrahydro-2H-pyran
Description:
2-[(5-Chloropentyl)oxy]tetrahydro-2H-pyran, with the CAS number 13129-60-7, is an organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether containing one oxygen atom. The presence of a 5-chloropentyl group indicates that there is a chlorine atom attached to a five-carbon alkyl chain, which contributes to the compound's hydrophobic properties. This compound is likely to exhibit moderate polarity due to the ether functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The chlorinated alkyl chain may enhance biological activity or alter the compound's solubility profile. Additionally, the compound's stability and reactivity can be influenced by the presence of the chlorine substituent, which may participate in nucleophilic substitution reactions. Overall, 2-[(5-Chloropentyl)oxy]tetrahydro-2H-pyran is a versatile compound with potential utility in various chemical applications.
Formula:C10H19ClO2
InChI:InChI=1S/C10H19ClO2/c11-7-3-1-4-8-12-10-6-2-5-9-13-10/h10H,1-9H2
InChI key:InChIKey=WLHOOFDTKPBKIY-UHFFFAOYSA-N
SMILES:O(CCCCCCl)C1CCCCO1
Synonyms:- 2-(5-Chloropentyloxy)tetrahydropyran
- 5-Chloro-1-pentanol tetrahydropyranyl ether
- 2H-Pyran, 2-[(5-chloropentyl)oxy]tetrahydro-
- Pyran, 2-[(5-chloropentyl)oxy]tetrahydro-
- 2-[(5-Chloropentyl)oxy]tetrahydro-2H-pyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
