CAS 13129-67-4

1-[(Dimethylamino)methyl]-1H-indole-2,3-dione

Description:

1-[(Dimethylamino)methyl]-1H-indole-2,3-dione, also known as a derivative of indole, is a chemical compound characterized by its indole core structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a dimethylamino group attached to a methylene bridge, which connects to the indole's nitrogen atom. The presence of the 2,3-dione functional groups indicates that it has two carbonyl (C=O) groups, contributing to its reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as fluorescence, and they can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound may also have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1/C11H12N2O2/c1-12(2)7-13-9-6-4-3-5-8(9)10(14)11(13)15/h3-6H,7H2,1-2H3

SMILES: CN(C)CN1c2ccccc2C(=O)C1=O

Synonyms:

• 1H-indole-2,3-dione, 1-[(dimethylamino)methyl]-

1-[(Dimethylamino)methyl]-1h-indole-2,3-dione

CAS: 13129-67-4

Formula: C₁₁H₁₂N₂O₂

Molecular weight: 204.2252

Ref: IN-DA000VV5