CAS 13129-81-2
:Undecylprodigiosin
Description:
Undecylprodigiosin is a natural red pigment belonging to the prodigiosin family, which are secondary metabolites produced by certain bacteria, notably from the genus *Serratia*. This compound is characterized by its long undecyl side chain, which contributes to its lipophilicity and biological activity. Undecylprodigiosin exhibits antimicrobial properties and has been studied for its potential applications in medicine, particularly in cancer research due to its ability to induce apoptosis in certain cancer cell lines. The compound is also known for its vibrant red color, which is a result of its conjugated system of double bonds. In terms of solubility, it is generally more soluble in organic solvents than in water, reflecting its hydrophobic nature. Additionally, undecylprodigiosin has been investigated for its role in bacterial communication and biofilm formation, highlighting its significance in microbial ecology. Overall, this compound represents a fascinating intersection of chemistry and biology, with potential implications in various fields, including pharmaceuticals and biotechnology.
Formula:C25H35N3O
InChI:InChI=1S/C25H35N3O/c1-3-4-5-6-7-8-9-10-11-13-20-15-16-21(27-20)18-24-25(29-2)19-23(28-24)22-14-12-17-26-22/h12,14-19,26-27H,3-11,13H2,1-2H3/b24-18-
InChI key:InChIKey=HIYSWASSDOXZLC-MOHJPFBDSA-N
SMILES:C(=C\1/C(OC)=CC(=N1)C2=CC=CN2)\C=3NC(CCCCCCCCCCC)=CC3
Synonyms:- 1H-Pyrrole, 2-[(Z)-[3-methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]-5-undecyl-
- Undecylprodiginin
- Undecylprodigiosin
- Undecylprodiginine
- 2-[(Z)-[3-Methoxy-5-(1H-pyrrol-2-yl)-2H-pyrrol-2-ylidene]methyl]-5-undecyl-1H-pyrrole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.