
CAS 1312935-07-1
:5H-Thiopyrano[4,3-d]pyrimidine, 2,4-dichloro-7,8-dihydro-, 6-oxide
Description:
5H-Thiopyrano[4,3-d]pyrimidine, 2,4-dichloro-7,8-dihydro-, 6-oxide, identified by its CAS number 1312935-07-1, is a heterocyclic compound characterized by a fused thiopyrano and pyrimidine structure. This compound features a thiophene ring fused to a pyrimidine, which contributes to its unique chemical properties. The presence of dichloro substituents at the 2 and 4 positions enhances its reactivity and potential biological activity. The 6-oxide functional group indicates the presence of an oxygen atom bonded to the sulfur atom in the thiopyrano structure, which may influence its electronic properties and stability. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of atoms and functional groups in this compound can lead to diverse interactions in biological systems, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C7H6Cl2N2OS
InChI:InChI=1S/C7H6Cl2N2OS/c8-6-4-3-13(12)2-1-5(4)10-7(9)11-6/h1-3H2
InChI key:InChIKey=QQNOTZOGGDXJEV-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(Cl)=N1)CCS(=O)C2
Synonyms:- 2,4-Dichloro-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidine 6-oxide
- 2,4-Dichloro-5H,7H,8H-6λ4-thiopyrano[4,3-d]pyrimidin-6-one
- 5H-Thiopyrano[4,3-d]pyrimidine, 2,4-dichloro-7,8-dihydro-, 6-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Dichloro-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidine 6-oxide
CAS:Formula:C7H6Cl2N2OSMolecular weight:237.1063
