CAS 1312942-16-7

B-[2-(1-Methylethyl)-5-pyrimidinyl]boronic acid

Description:

B-[2-(1-Methylethyl)-5-pyrimidinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrimidine ring. This compound typically exhibits properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. The boronic acid moiety allows for reversible covalent bonding with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the isopropyl group on the pyrimidine ring contributes to its lipophilicity, potentially enhancing its biological activity. Additionally, this compound may participate in Suzuki coupling reactions, a common method for forming carbon-carbon bonds in organic synthesis. Its unique structure and functional groups make it a valuable building block in the development of pharmaceuticals and agrochemicals. Overall, B-[2-(1-Methylethyl)-5-pyrimidinyl]boronic acid is notable for its versatility in chemical reactions and potential applications in drug discovery and material science.

Formula: C₇H₁₁BN₂O₂

InChI: InChI=1S/C7H11BN2O2/c1-5(2)7-9-3-6(4-10-7)8(11)12/h3-5,11-12H,1-2H3

InChI key: InChIKey=JVYHCLGHZUTXHU-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=NC(C(C)C)=NC1

Synonyms:

• (2-Isopropylpyrimidin-5-yl)boronic acid
• Boronic acid, B-[2-(1-methylethyl)-5-pyrimidinyl]-
• B-[2-(1-Methylethyl)-5-pyrimidinyl]boronic acid

(2-Isopropylpyrimidin-5-yl)boronic acid

CAS: 1312942-16-7

Formula: C₇H₁₁BN₂O₂

Molecular weight: 165.9854

Ref: IN-DA00HSF4