
CAS 1312949-23-7
:3-Chloro-1,7-dihydro-1,4-dimethyl-6H-pyrazolo[3,4-b]pyridin-6-one
Description:
3-Chloro-1,7-dihydro-1,4-dimethyl-6H-pyrazolo[3,4-b]pyridin-6-one is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both pyrazole and pyridine rings. This compound features a chlorine substituent at the 3-position and two methyl groups at the 1 and 4 positions of the pyrazole ring. The presence of the carbonyl group contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its CAS number, 1312949-23-7, allows for easy identification in chemical databases. As with many heterocycles, it may exhibit interesting electronic properties and reactivity patterns, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C8H8ClN3O
InChI:InChI=1S/C8H8ClN3O/c1-4-3-5(13)10-8-6(4)7(9)11-12(8)2/h3H,1-2H3,(H,10,13)
InChI key:InChIKey=UHBJOGIIZPFFHO-UHFFFAOYSA-N
SMILES:CN1C2=C(C(Cl)=N1)C(C)=CC(=O)N2
Synonyms:- 6H-Pyrazolo[3,4-b]pyridin-6-one, 3-chloro-1,7-dihydro-1,4-dimethyl-
- 3-Chloro-1,7-dihydro-1,4-dimethyl-6H-pyrazolo[3,4-b]pyridin-6-one
- 3-Chloro-1,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6(7H)-one
- 3-Chloro-1,4-dimethyl-1H,6H,7H-pyrazolo[3,4-b]pyridin-6-one
- 3-Chloro-1,4-dimethyl-1H-pyrazolo[3,4-b]pyridin-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.