CAS 13130-43-3
:2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID
Description:
2-Acetylamino-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid, with the CAS number 13130-43-3, is a chemical compound characterized by its unique structure that includes a benzo[b]thiophene core, which is a fused bicyclic system containing both benzene and thiophene rings. This compound features an acetylamino group and a carboxylic acid functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the tetrahydro moiety indicates that the compound is partially saturated, which may influence its physical properties, such as melting point and boiling point. It is likely to exhibit biological activity due to the presence of the carboxylic acid and amine functionalities, which can participate in hydrogen bonding and other interactions. The compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C11H13NO3S
InChI:InChI=1/C11H13NO3S/c1-6(13)12-10-9(11(14)15)7-4-2-3-5-8(7)16-10/h2-5H2,1H3,(H,12,13)(H,14,15)
SMILES:CC(=Nc1c(c2CCCCc2s1)C(=O)O)O
Synonyms:- 2-Acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
- Benzo[b]thiophene-3-carboxylic acid, 2-(acetylamino)-4,5,6,7-tetrahydro-
- 2-(Acetylamino)-4,5,6,7-Tetrahydro-1-Benzothiophene-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Acetylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
CAS:Formula:C11H13NO3SMolecular weight:239.2908
