CAS 13130-79-5
:1-BROMOISOQUINOLIN-3-AMINE
Description:
1-Bromoisoquinolin-3-amine is an organic compound characterized by the presence of a bromine atom and an amino group attached to an isoquinoline structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and bromine, reflecting its heterocyclic nature. The compound features a bromine substituent at the first position and an amino group at the third position of the isoquinoline ring system, which contributes to its reactivity and potential applications in medicinal chemistry. 1-Bromoisoquinolin-3-amine may exhibit properties such as being a potential building block for the synthesis of various pharmaceuticals or biologically active compounds. Its structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, the presence of the bromine atom can enhance its electrophilic character, facilitating further reactions. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose specific health and environmental risks. Overall, this compound is of interest in research fields focused on drug development and organic synthesis.
Formula:C9H7BrN2
InChI:InChI=1/C9H7BrN2/c10-9-7-4-2-1-3-6(7)5-8(11)12-9/h1-5H,(H2,11,12)
SMILES:c1ccc2c(c1)cc(N)nc2Br
Synonyms:- 1-Bromoisoquinolin-3-Ylamine
- 1-Bromoisoquinoline-3-Amine
- 3-Amino-1-Bromoisoquinoline
- 3-Amino-1-bromoisoquinoline 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-1-bromoisoquinoline, 97+%
CAS:3-Amino-1-bromoisoquinoline is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refer
Formula:C9H7BrN2Purity:97+%Molecular weight:223.073-Isoquinolinamine, 1-bromo-
CAS:Formula:C9H7BrN2Purity:97%Color and Shape:SolidMolecular weight:223.06933-Amino-1-bromoisoquinoline
CAS:3-Amino-1-bromoisoquinolineFormula:C9H7BrN2Purity:≥95%Color and Shape: yellow solidMolecular weight:223.07g/mol1-Bromoisoquinolin-3-amine
CAS:1-Bromoisoquinolin-3-amine is a naphthyridine that can be synthesized by the reaction of 1-chloroisonicotinic acid with sodium azide and bromine. This compound has the potential to be used for the synthesis of other compounds, such as thiazolopyrimidines and benzothiazoles. Irradiation of 1-Bromoisoquinolin-3-amine in a nitrogen atmosphere yields an isomer with a phosphite group at C2. The tricycle structure of this isomer makes it reactive towards nucleophilic substitution reactions, making it useful for synthetic purposes.Formula:C9H7BrN2Purity:Min. 95%Molecular weight:223.07 g/mol




