CAS 13131-49-2
:Formyl CoA
Description:
Formyl CoA, or formyl coenzyme A, is a key biochemical compound involved in various metabolic pathways, particularly in the synthesis and degradation of fatty acids and amino acids. It is characterized by the presence of a formyl group (-CHO) attached to the coenzyme A structure, which is essential for its role as an acyl carrier in metabolic reactions. Formyl CoA plays a crucial role in the formylation of substrates, facilitating the transfer of the formyl group in biosynthetic processes. It is typically found in the cytoplasm of cells and is involved in the metabolism of certain amino acids, such as methionine and tryptophan. The compound is also significant in the context of energy production and the synthesis of various biomolecules. Its reactivity is influenced by the presence of the thiol group in coenzyme A, allowing it to participate in acylation reactions. Overall, Formyl CoA is an important intermediate in cellular metabolism, contributing to the regulation of various biochemical pathways.
Formula:C22H36N7O17P3S
InChI:InChI=1S/C22H36N7O17P3S/c1-22(2,17(33)20(34)25-4-3-13(31)24-5-6-50-11-30)8-43-49(40,41)46-48(38,39)42-7-12-16(45-47(35,36)37)15(32)21(44-12)29-10-28-14-18(23)26-9-27-19(14)29/h9-12,15-17,21,32-33H,3-8H2,1-2H3,(H,24,31)(H,25,34)(H,38,39)(H,40,41)(H2,23,26,27)(H2,35,36,37)/t12-,15-,16-,17+,21-/m1/s1
InChI key:InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)O[C@H](COP(OP(OCC([C@H](C(NCCC(NCCSC=O)=O)=O)O)(C)C)(=O)O)(=O)O)[C@H]1OP(=O)(O)O
Synonyms:- Formyl CoA
- Formyl coenzyme A
- Coenzyme A, S-formate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
