CAS 131311-66-5
:4,5-Diamino-1-benzyl-1H-pyrazole
Description:
4,5-Diamino-1-benzyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which features two amino groups at the 4 and 5 positions and a benzyl group at the 1 position. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The presence of the benzyl group can enhance its lipophilicity, potentially affecting its biological activity and interactions. 4,5-Diamino-1-benzyl-1H-pyrazole may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been investigated for various pharmacological activities. Its reactivity can be influenced by the amino groups, making it a candidate for further chemical modifications. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H12N4
InChI:InChI=1S/C10H12N4/c11-9-6-13-14(10(9)12)7-8-4-2-1-3-5-8/h1-6H,7,11-12H2
InChI key:InChIKey=URPJUMVYJFHGOR-UHFFFAOYSA-N
SMILES:C(N1C(N)=C(N)C=N1)C2=CC=CC=C2
Synonyms:- 4,5-Diamino-1-benzylpyrazole
- 1-(Phenylmethyl)-1H-pyrazole-4,5-diamine
- 1H-Pyrazole-4,5-diamine, 1-(phenylmethyl)-
- 4,5-Diamino-1-benzyl-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
