CymitQuimica logo

CAS 1313183-08-2

:

(αR)-α-Amino-3-pyrrolidinepropanoic acid

Description:
(αR)-α-Amino-3-pyrrolidinepropanoic acid, also known as a specific amino acid derivative, is characterized by its unique structural features that include a pyrrolidine ring and an amino acid backbone. This compound is classified as a non-proteinogenic amino acid, meaning it is not commonly found in proteins but may play roles in various biological processes. Its stereochemistry, indicated by the (αR) designation, suggests that it has a specific spatial arrangement of atoms, which can influence its biological activity and interactions with receptors or enzymes. The presence of both an amino group and a carboxylic acid group makes it amphoteric, allowing it to act as both an acid and a base. This compound may exhibit properties such as solubility in polar solvents and potential reactivity in biochemical pathways. Its applications could extend to fields such as pharmaceuticals, where it may serve as a building block for drug synthesis or as a research tool in studying neurotransmitter systems or metabolic pathways.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c8-6(7(10)11)3-5-1-2-9-4-5/h5-6,9H,1-4,8H2,(H,10,11)/t5?,6-/m1/s1
InChI key:InChIKey=UJGNCYAOIKEUNK-PRJDIBJQSA-N
SMILES:C([C@H](C(O)=O)N)C1CCNC1
Synonyms:
  • (αR)-α-Amino-3-pyrrolidinepropanoic acid
  • 3-Pyrrolidinepropanoic acid, α-amino-, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.