
CAS 1313237-25-0
:2-[2-(Bromomethyl)phenyl]-2H-1,2,3-triazole
Description:
2-[2-(Bromomethyl)phenyl]-2H-1,2,3-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a bromomethyl group attached to a phenyl ring, contributing to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the bromomethyl group enhances its ability to participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the triazole moiety is known for its biological activity, often serving as a scaffold in the development of pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 2-[2-(Bromomethyl)phenyl]-2H-1,2,3-triazole represents a significant structure in the realm of organic chemistry, with potential uses in drug development and other chemical syntheses.
Formula:C9H8BrN3
InChI:InChI=1S/C9H8BrN3/c10-7-8-3-1-2-4-9(8)13-11-5-6-12-13/h1-6H,7H2
InChI key:InChIKey=HXULVNADRAEHMY-UHFFFAOYSA-N
SMILES:C(Br)C1=C(C=CC=C1)N2N=CC=N2
Synonyms:- 2H-1,2,3-Triazole, 2-[2-(bromomethyl)phenyl]-
- 2-[2-(Bromomethyl)phenyl]-2H-1,2,3-triazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.