CAS 1313369-57-1

Phenylmethyl 3,3-bis(hydroxymethyl)-1-piperidinecarboxylate

Description:

Phenylmethyl 3,3-bis(hydroxymethyl)-1-piperidinecarboxylate, identified by its CAS number 1313369-57-1, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of two hydroxymethyl groups attached to the 3-position of the piperidine ring, contributing to its potential reactivity and solubility in polar solvents. The phenylmethyl group enhances its lipophilicity, which may influence its biological activity and interaction with various biological targets. The carboxylate functional group suggests potential for forming esters or participating in acid-base reactions. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features indicate potential applications in various fields, including pharmaceuticals and organic synthesis, although specific biological activities and applications would require further investigation.

Formula: C₁₅H₂₁NO₄

InChI: InChI=1S/C15H21NO4/c17-11-15(12-18)7-4-8-16(10-15)14(19)20-9-13-5-2-1-3-6-13/h1-3,5-6,17-18H,4,7-12H2

InChI key: InChIKey=UYFWZFFZNKABAN-UHFFFAOYSA-N

SMILES: C(O)C1(CO)CN(C(OCC2=CC=CC=C2)=O)CCC1

Synonyms:

• Phenylmethyl 3,3-bis(hydroxymethyl)-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3,3-bis(hydroxymethyl)-, phenylmethyl ester