CymitQuimica logo

CAS 1313369-58-2

:

Phenylmethyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate

Description:
Phenylmethyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an oxirane and an azaspiro moiety. This compound features a phenylmethyl group, contributing to its aromatic properties, and a carboxylate functional group, which can influence its reactivity and solubility. The presence of the nitrogen atom in the azaspiro structure may impart basicity and potential for hydrogen bonding, affecting its interactions with other molecules. The compound's spirocyclic nature often leads to interesting conformational dynamics, which can impact its biological activity and pharmacological properties. As with many organic compounds, its stability, solubility, and reactivity can vary significantly depending on the surrounding environment, including factors such as pH and solvent polarity. Overall, Phenylmethyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate represents a complex structure that may have applications in medicinal chemistry or materials science, although specific biological or industrial uses would require further investigation.
Formula:C15H19NO3
InChI:InChI=1S/C15H19NO3/c17-14(19-9-13-5-2-1-3-6-13)16-8-4-7-15(10-16)11-18-12-15/h1-3,5-6H,4,7-12H2
InChI key:InChIKey=HCKQTCITKDUTRG-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(COC3)CCC2
Synonyms:
  • 2-Oxa-6-azaspiro[3.5]nonane-6-carboxylic acid, phenylmethyl ester
  • Phenylmethyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.