
CAS 131339-23-6
:17(18)-EpETE
Description:
17(18)-EpETE, also known as 17(18)-epoxy-eicosatetraenoic acid, is a bioactive lipid derived from arachidonic acid, which is a polyunsaturated fatty acid. This compound is characterized by its epoxy group, which contributes to its reactivity and biological activity. It is part of the family of epoxyeicosatrienoic acids (EETs), known for their role in various physiological processes, including vasodilation, inflammation, and cellular signaling. 17(18)-EpETE is particularly noted for its potential effects on cardiovascular health and its involvement in the regulation of blood pressure. The compound exhibits lipophilic properties, allowing it to interact with cell membranes and influence various signaling pathways. Additionally, it can be metabolized by specific enzymes, leading to the formation of other biologically active metabolites. Research into 17(18)-EpETE continues to explore its therapeutic potential and mechanisms of action in various biological systems.
Formula:C20H30O3
InChI:InChI=1/C20H30O3/c1-2-18-19(23-18)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(21)22/h3,5-6,8-9,11-12,14,18-19H,2,4,7,10,13,15-17H2,1H3,(H,21,22)/b5-3-,8-6-,11-9-,14-12-/t18-,19+/s2
InChI key:InChIKey=GPQVVJQEBXAKBJ-GPXISJDBNA-N
SMILES:C(/C=C\C/C=C\C/C=C\C/C=C\CCCC(O)=O)[C@H]1[C@@H](CC)O1
Synonyms:- 5,8,11,14-Hexadecatetraenoic acid, 16-[(2R,3S)-3-ethyl-2-oxiranyl]-, (5Z,8Z,11Z,14Z)-rel-
- rel-(5Z,8Z,11Z,14Z)-16-[(2R,3S)-3-Ethyl-2-oxiranyl]-5,8,11,14-hexadecatetraenoic acid
- 5,8,11,14-Hexadecatetraenoic acid, 16-[(2R,3S)-3-ethyloxiranyl]-, (5Z,8Z,11Z,14Z)-rel-
- 5,8,11,14-Hexadecatetraenoic acid, 16-(3-ethyloxiranyl)-, [2α(5Z,8Z,11Z,14Z),3α]-
- cis-17(18)-Epete
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,8,11,14-Hexadecatetraenoic acid, 16-[(2R,3S)-3-ethyl-2-oxiranyl]-, (5Z,8Z,11Z,14Z)-rel-
CAS:Formula:C20H30O3Molecular weight:318.4504
