CymitQuimica logo

CAS 1313393-63-3

:

1-(3-Chlorophenyl)piperazine-d8 hydrochloride solution

Description:
The chemical substance with the CAS number 1313393-63-3 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties depending on their molecular structure, functional groups, and intended applications. Characteristics typically assessed include physical properties such as melting point, boiling point, solubility, and density, as well as chemical properties like reactivity, stability, and potential toxicity. Additionally, the compound may have specific uses in various industries, including pharmaceuticals, agriculture, or materials science. For precise information regarding this particular substance, including safety data and regulatory status, consulting specialized chemical databases or scientific literature is recommended. Always ensure to handle chemicals with appropriate safety measures and in accordance with relevant regulations.
Formula:C10H14Cl2N2
InChI:InChI=1S/C10H13ClN2.ClH/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13;/h1-3,8,12H,4-7H2;1H/i4D2,5D2,6D2,7D2;
InChI key:InChIKey=MHXPYWFZULXYHT-HXCXULITSA-N
SMILES:ClC=1C=C(C=CC1)N2C(C(NC(C2([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H].Cl
Synonyms:
  • [Synonyms]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.