CymitQuimica logo

CAS 13134-39-9

:

N-Butyl-3,6-dimethyl-2-pyrazinamine

Description:
N-Butyl-3,6-dimethyl-2-pyrazinamine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a butyl group and two methyl groups attached to the pyrazine ring, specifically at the 3 and 6 positions, and an amino group at the 2 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. N-Butyl-3,6-dimethyl-2-pyrazinamine is likely to exhibit moderate solubility in organic solvents due to its hydrophobic butyl chain, while the amino group may impart some degree of polarity. Its molecular structure suggests potential for hydrogen bonding, which can influence its physical properties, such as boiling and melting points. Additionally, the compound's unique arrangement of substituents may affect its biological activity, making it a subject of interest for further research in medicinal chemistry. Safety data and handling precautions should be consulted due to the potential toxicity associated with nitrogen-containing heterocycles.
Formula:C10H17N3
InChI:InChI=1S/C10H17N3/c1-4-5-6-11-10-9(3)12-7-8(2)13-10/h7H,4-6H2,1-3H3,(H,11,13)
InChI key:InChIKey=XBLDYEIENDPMDB-UHFFFAOYSA-N
SMILES:N(CCCC)C=1C(C)=NC=C(C)N1
Synonyms:
  • Pyrazine, 3-(butylamino)-2,5-dimethyl-
  • N-Butyl-3,6-dimethyl-2-pyrazinamine
  • 2-Pyrazinamine, N-butyl-3,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.