CAS 131346-22-0

N-Hydroxy-4-pyrimidinecarboxamide

Description:

N-Hydroxy-4-pyrimidinecarboxamide, with the CAS number 131346-22-0, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a hydroxylamine functional group (-NHOH) attached to the 4-position of the pyrimidine ring, along with a carboxamide group (-C(=O)NH2) at the 2-position. The presence of these functional groups contributes to its potential reactivity and solubility in polar solvents. N-Hydroxy-4-pyrimidinecarboxamide may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in various chemical environments. Additionally, the compound's stability and reactivity can be affected by factors such as pH and temperature, which are important considerations in its application and handling. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse applications in chemical and biological contexts.

Formula: C₅H₅N₃O₂

InChI: InChI=1S/C5H5N3O2/c9-5(8-10)4-1-2-6-3-7-4/h1-3,10H,(H,8,9)

InChI key: InChIKey=ZOCWDWMASUCTTI-UHFFFAOYSA-N

SMILES: C(NO)(=O)C=1C=CN=CN1

Synonyms:

• 4-Pyrimidinecarboxamide, N-hydroxy-
• N-Hydroxy-4-pyrimidinecarboxamide