
CAS 1313588-95-2
:Benzenamine, 2-bromo-4-fluoro-5-methyl-, hydrochloride (1:1)
Description:
Benzenamine, 2-bromo-4-fluoro-5-methyl-, hydrochloride (1:1), also known by its CAS number 1313588-95-2, is a chemical compound characterized by its aromatic amine structure. This compound features a benzene ring substituted with a bromine atom at the second position, a fluorine atom at the fourth position, and a methyl group at the fifth position. The presence of the amine functional group contributes to its basicity and potential reactivity in various chemical reactions. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it easier to handle in laboratory settings. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific properties, such as melting point, boiling point, and solubility, can vary based on the conditions and purity of the sample. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:C7H7BrFN·ClH
InChI:InChI=1S/C7H7BrFN.ClH/c1-4-2-7(10)5(8)3-6(4)9;/h2-3H,10H2,1H3;1H
InChI key:InChIKey=UYCSOCCYOIVHPW-UHFFFAOYSA-N
SMILES:BrC1=C(N)C=C(C)C(F)=C1.Cl
Synonyms:- Benzenamine, 2-bromo-4-fluoro-5-methyl-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromo-4-fluoro-5-methylaniline hydrochloride
CAS:2-Bromo-4-fluoro-5-methylaniline hydrochloridePurity:≥95%Molecular weight:240.50g/mol2-Bromo-4-fluoro-5-methylaniline hydrochloride
CAS:2-Bromo-4-fluoro-5-methylaniline hydrochloride is a versatile building block that can be used in the synthesis of complex compounds. It has two bromine atoms, two chlorine atoms, and one fluorine atom and is classified as a research chemical. This compound is used as a reagent in organic chemistry and as a speciality chemical. 2-Bromo-4-fluoro-5-methylaniline hydrochloride is also an intermediate for the synthesis of other chemicals and has been shown to be useful for the synthesis of new scaffolds.Formula:C7H7BrFN·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:240.5 g/mol

