CymitQuimica logo

CAS 1313593-60-0

:

Benzenemethanamine, α-ethyl-2,6-difluoro-, hydrochloride (1:1), (αR)-

Description:
Benzenemethanamine, α-ethyl-2,6-difluoro-, hydrochloride (1:1), (αR)- is a chemical compound characterized by its amine functional group and a substituted benzene ring. This substance features a difluoroethyl group at the 2 and 6 positions of the aromatic ring, which can influence its reactivity and biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. The (αR)- designation refers to the specific stereochemistry of the compound, indicating that it has a particular three-dimensional arrangement of atoms that can affect its interaction with biological systems. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the context of drug development. Its properties, such as melting point, solubility, and reactivity, would be influenced by the presence of the difluoro substituents and the amine group, making it a candidate for further study in medicinal chemistry.
Formula:C9H11F2N·ClH
InChI:InChI=1S/C9H11F2N.ClH/c1-2-8(12)9-6(10)4-3-5-7(9)11;/h3-5,8H,2,12H2,1H3;1H/t8-;/m1./s1
InChI key:InChIKey=UGDJAJVQNBJWQB-DDWIOCJRSA-N
SMILES:[C@H](CC)(N)C1=C(F)C=CC=C1F.Cl
Synonyms:
  • Benzenemethanamine, α-ethyl-2,6-difluoro-, hydrochloride (1:1), (αR)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.